![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Reference chemical s..> | 2018-11-29 17:25 | 98M | |
| S1 Mode consolidatio..> | 2018-11-29 17:25 | 12K | |
| S2 The full unfilter..> | 2018-11-29 17:25 | 39M | |
| S3 CTD dictionary fi..> | 2018-11-29 17:25 | 13K | |
| S4 LitDB processing ..> | 2018-11-29 17:25 | 100K | |
| S5 The target symbol..> | 2018-11-29 17:25 | 54K | |
| S6 Targets selected ..> | 2018-11-29 17:25 | 13K | |
| S7 The filtered cont..> | 2018-11-29 17:25 | 45M | |
| S8 Comparisons of ca..> | 2018-11-29 17:25 | 2.4M | |
| S9 Statistics of the..> | 2018-11-29 17:25 | 24K | |
| S10 Statistics of th..> | 2018-11-29 17:25 | 621K | |
| S11 Results of manua..> | 2018-11-29 17:25 | 108K | |
| S12 Candidate refere..> | 2018-11-29 17:25 | 14M | |
| S13 LitDB data file...> | 2018-11-29 17:25 | 17M | |